C26H33NO4 — CID 15391990
[4-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 15391990) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is [4-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 15391990 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [4-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC(Cc3ccc(OC)c(OC4CCCC4)c3)CC2)cc1 |
| InChI | InChI=1S/C26H33NO4/c1-29-22-10-8-21(9-11-22)26(28)27-15-13-19(14-16-27)17-20-7-12-24(30-2)25(18-20)31-23-5-3-4-6-23/h7-12,18-19,23H,3-6,13-17H2,1-2H3 |
| InChIKey | UUBYHCLHAVPMRF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |