C25H33N2O3+ — CID 67583346
[4-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-1-methylpyridin-1-ium-2-yl]-piperidin-1-ylmethanone (PubChem CID 67583346) has the molecular formula C25H33N2O3+ and a molecular weight of 409.55 g/mol. Its IUPAC name is [4-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-1-methylpyridin-1-ium-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [4-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-1-methylpyridin-1-ium-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 67583346 |
| Molecular Formula | C25H33N2O3+ |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | [4-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-1-methylpyridin-1-ium-2-yl]-piperidin-1-ylmethanone |
| SMILES | COc1ccc(Cc2cc[n+](C)c(C(=O)N3CCCCC3)c2)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H33N2O3/c1-26-15-12-20(17-22(26)25(28)27-13-6-3-7-14-27)16-19-10-11-23(29-2)24(18-19)30-21-8-4-5-9-21/h10-12,15,17-18,21H,3-9,13-14,16H2,1-2H3/q+1 |
| InChIKey | STJYENAUHWXMGR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|