C27H30N2O5 — CID 68552535
ethyl 4-[3-cyclopentyloxy-4-methoxy-N-[(6-oxo-1H-pyridin-3-yl)methyl]anilino]benzoate (PubChem CID 68552535) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is ethyl 4-[3-cyclopentyloxy-4-methoxy-N-[(6-oxo-1H-pyridin-3-yl)methyl]anilino]benzoate.
| Compound Name | ethyl 4-[3-cyclopentyloxy-4-methoxy-N-[(6-oxo-1H-pyridin-3-yl)methyl]anilino]benzoate |
|---|---|
| PubChem CID | 68552535 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | ethyl 4-[3-cyclopentyloxy-4-methoxy-N-[(6-oxo-1H-pyridin-3-yl)methyl]anilino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2ccc(=O)[nH]c2)c2ccc(OC)c(OC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C27H30N2O5/c1-3-33-27(31)20-9-11-21(12-10-20)29(18-19-8-15-26(30)28-17-19)22-13-14-24(32-2)25(16-22)34-23-6-4-5-7-23/h8-17,23H,3-7,18H2,1-2H3,(H,28,30) |
| InChIKey | RSZBJCYDFKTXKP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |