C30H38N5O5+ — CID 54170215
3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-8-[2-[(3,4-dimethoxyphenyl)methoxy]propan-2-yl]-7H-purin-3-ium-6-amine (PubChem CID 54170215) has the molecular formula C30H38N5O5+ and a molecular weight of 548.66 g/mol. Its IUPAC name is 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-8-[2-[(3,4-dimethoxyphenyl)methoxy]propan-2-yl]-7H-purin-3-ium-6-amine.
| Compound Name | 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-8-[2-[(3,4-dimethoxyphenyl)methoxy]propan-2-yl]-7H-purin-3-ium-6-amine |
|---|---|
| PubChem CID | 54170215 |
| Molecular Formula | C30H38N5O5+ |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-8-[2-[(3,4-dimethoxyphenyl)methoxy]propan-2-yl]-7H-purin-3-ium-6-amine |
| SMILES | COc1ccc(COC(C)(C)c2nc3c([nH]2)c(N)nc[n+]3Cc2ccc(OC)c(OC3CCCC3)c2)cc1OC |
| InChI | InChI=1S/C30H37N5O5/c1-30(2,39-17-20-11-13-22(36-3)24(15-20)38-5)29-33-26-27(31)32-18-35(28(26)34-29)16-19-10-12-23(37-4)25(14-19)40-21-8-6-7-9-21/h10-15,18,21H,6-9,16-17H2,1-5H3,(H2,31,33,34)/p+1 |
| InChIKey | QHQXILIGOHOMJH-UHFFFAOYSA-O |
| XLogP | 4.68 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|