C20H26N2O4 — CID 70088740
ethyl 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethyl]pyrazole-1-carboxylate (PubChem CID 70088740) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is ethyl 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethyl]pyrazole-1-carboxylate.
| Compound Name | ethyl 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 70088740 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | ethyl 3-[2-(3-cyclopentyloxy-4-methoxyphenyl)ethyl]pyrazole-1-carboxylate |
| SMILES | CCOC(=O)n1ccc(CCc2ccc(OC)c(OC3CCCC3)c2)n1 |
| InChI | InChI=1S/C20H26N2O4/c1-3-25-20(23)22-13-12-16(21-22)10-8-15-9-11-18(24-2)19(14-15)26-17-6-4-5-7-17/h9,11-14,17H,3-8,10H2,1-2H3 |
| InChIKey | VEJWIAHLCVKWDA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |