C18H14BrClN6 — CID 155461628
3-[(4-bromo-2-chloro-3-pyridinyl)methyl]-8-(2-methylphenyl)-7H-purin-6-imine (PubChem CID 155461628) has the molecular formula C18H14BrClN6 and a molecular weight of 429.71 g/mol. Its IUPAC name is 3-[(4-bromo-2-chloro-3-pyridinyl)methyl]-8-(2-methylphenyl)-7H-purin-6-imine.
| Compound Name | 3-[(4-bromo-2-chloro-3-pyridinyl)methyl]-8-(2-methylphenyl)-7H-purin-6-imine |
|---|---|
| PubChem CID | 155461628 |
| Molecular Formula | C18H14BrClN6 |
| Molecular Weight | 429.71 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 3-[(4-bromo-2-chloro-3-pyridinyl)methyl]-8-(2-methylphenyl)-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2c(Br)ccnc2Cl)c2nc(-c3ccccc3C)[nH]c12 |
| InChI | InChI=1S/C18H14BrClN6/c1-10-4-2-3-5-11(10)17-24-14-16(21)23-9-26(18(14)25-17)8-12-13(19)6-7-22-15(12)20/h2-7,9,21H,8H2,1H3,(H,24,25)/b21-16- |
| InChIKey | XRIMVZNZEMUDGV-PGMHBOJBSA-N |
| XLogP | 4.07 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.71 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|