C18H14Cl2N6O — CID 138740748
3-[(2,6-dichlorophenyl)methyl]-8-(4-methoxy-3-pyridinyl)-7H-purin-6-imine (PubChem CID 138740748) has the molecular formula C18H14Cl2N6O and a molecular weight of 401.26 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-8-(4-methoxy-3-pyridinyl)-7H-purin-6-imine.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-8-(4-methoxy-3-pyridinyl)-7H-purin-6-imine |
|---|---|
| PubChem CID | 138740748 |
| Molecular Formula | C18H14Cl2N6O |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-8-(4-methoxy-3-pyridinyl)-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2c(Cl)cccc2Cl)c2nc(-c3cnccc3OC)[nH]c12 |
| InChI | InChI=1S/C18H14Cl2N6O/c1-27-14-5-6-22-7-10(14)17-24-15-16(21)23-9-26(18(15)25-17)8-11-12(19)3-2-4-13(11)20/h2-7,9,21H,8H2,1H3,(H,24,25)/b21-16- |
| InChIKey | LMUXBHQJTVOOHG-PGMHBOJBSA-N |
| XLogP | 3.66 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |