C23H26N6O2 — CID 175263524
4-[2-[8-(2,5-dimethoxyphenyl)-6-imino-7H-purin-3-yl]ethyl]-N,N-dimethylaniline (PubChem CID 175263524) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-[2-[8-(2,5-dimethoxyphenyl)-6-imino-7H-purin-3-yl]ethyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[8-(2,5-dimethoxyphenyl)-6-imino-7H-purin-3-yl]ethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 175263524 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 4-[2-[8-(2,5-dimethoxyphenyl)-6-imino-7H-purin-3-yl]ethyl]-N,N-dimethylaniline |
| SMILES | [H]/N=c1\ncn(CCc2ccc(N(C)C)cc2)c2nc(-c3cc(OC)ccc3OC)[nH]c12 |
| InChI | InChI=1S/C23H26N6O2/c1-28(2)16-7-5-15(6-8-16)11-12-29-14-25-21(24)20-23(29)27-22(26-20)18-13-17(30-3)9-10-19(18)31-4/h5-10,13-14,24H,11-12H2,1-4H3,(H,26,27)/b24-21- |
| InChIKey | YXFSQVPTNQXQQE-FLFQWRMESA-N |
| XLogP | 3.23 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|