C19H15ClFN5OS — CID 136613786
[4-chloro-3-[[6-imino-3-(2-phenylethyl)-7H-purin-8-yl]sulfanyl]phenyl] hypofluorite (PubChem CID 136613786) has the molecular formula C19H15ClFN5OS and a molecular weight of 415.88 g/mol. Its IUPAC name is [4-chloro-3-[[6-imino-3-(2-phenylethyl)-7H-purin-8-yl]sulfanyl]phenyl] hypofluorite.
| Compound Name | [4-chloro-3-[[6-imino-3-(2-phenylethyl)-7H-purin-8-yl]sulfanyl]phenyl] hypofluorite |
|---|---|
| PubChem CID | 136613786 |
| Molecular Formula | C19H15ClFN5OS |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [4-chloro-3-[[6-imino-3-(2-phenylethyl)-7H-purin-8-yl]sulfanyl]phenyl] hypofluorite |
| SMILES | [H]/N=c1\ncn(CCc2ccccc2)c2nc(Sc3cc(OF)ccc3Cl)[nH]c12 |
| InChI | InChI=1S/C19H15ClFN5OS/c20-14-7-6-13(27-21)10-15(14)28-19-24-16-17(22)23-11-26(18(16)25-19)9-8-12-4-2-1-3-5-12/h1-7,10-11,22H,8-9H2,(H,24,25)/b22-17- |
| InChIKey | XQLUSUUDFHIURX-XLNRJJMWSA-N |
| XLogP | 4.55 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |