C19H20N6O2S — CID 135906955
8-(2,5-dimethoxyphenyl)sulfanyl-3-(2-pyrrol-1-ylethyl)-7H-purin-6-imine (PubChem CID 135906955) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is 8-(2,5-dimethoxyphenyl)sulfanyl-3-(2-pyrrol-1-ylethyl)-7H-purin-6-imine.
| Compound Name | 8-(2,5-dimethoxyphenyl)sulfanyl-3-(2-pyrrol-1-ylethyl)-7H-purin-6-imine |
|---|---|
| PubChem CID | 135906955 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 8-(2,5-dimethoxyphenyl)sulfanyl-3-(2-pyrrol-1-ylethyl)-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(CCn2cccc2)c2nc(Sc3cc(OC)ccc3OC)[nH]c12 |
| InChI | InChI=1S/C19H20N6O2S/c1-26-13-5-6-14(27-2)15(11-13)28-19-22-16-17(20)21-12-25(18(16)23-19)10-9-24-7-3-4-8-24/h3-8,11-12,20H,9-10H2,1-2H3,(H,22,23)/b20-17- |
| InChIKey | RZRGBDBMWPKJIC-JZJYNLBNSA-N |
| XLogP | 2.91 |
| TPSA | 93.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |