C18H14Cl2N6S — CID 136967449
8-(2,4-dichlorophenyl)sulfanyl-3-(2-pyridin-2-ylethyl)-7H-purin-6-imine (PubChem CID 136967449) has the molecular formula C18H14Cl2N6S and a molecular weight of 417.33 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)sulfanyl-3-(2-pyridin-2-ylethyl)-7H-purin-6-imine.
| Compound Name | 8-(2,4-dichlorophenyl)sulfanyl-3-(2-pyridin-2-ylethyl)-7H-purin-6-imine |
|---|---|
| PubChem CID | 136967449 |
| Molecular Formula | C18H14Cl2N6S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 8-(2,4-dichlorophenyl)sulfanyl-3-(2-pyridin-2-ylethyl)-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(CCc2ccccn2)c2nc(Sc3ccc(Cl)cc3Cl)[nH]c12 |
| InChI | InChI=1S/C18H14Cl2N6S/c19-11-4-5-14(13(20)9-11)27-18-24-15-16(21)23-10-26(17(15)25-18)8-6-12-3-1-2-7-22-12/h1-5,7,9-10,21H,6,8H2,(H,24,25)/b21-16- |
| InChIKey | GGMZCXWSSCSCEG-PGMHBOJBSA-N |
| XLogP | 4.33 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |