C15H11Cl2N3O2 — CID 11580840
5,7-dichloro-8-hydroxy-3-(2-pyridin-2-ylethyl)quinazolin-4-one (PubChem CID 11580840) has the molecular formula C15H11Cl2N3O2 and a molecular weight of 336.18 g/mol. Its IUPAC name is 5,7-dichloro-8-hydroxy-3-(2-pyridin-2-ylethyl)quinazolin-4-one.
| Compound Name | 5,7-dichloro-8-hydroxy-3-(2-pyridin-2-ylethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 11580840 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 5,7-dichloro-8-hydroxy-3-(2-pyridin-2-ylethyl)quinazolin-4-one |
| SMILES | O=c1c2c(Cl)cc(Cl)c(O)c2ncn1CCc1ccccn1 |
| InChI | InChI=1S/C15H11Cl2N3O2/c16-10-7-11(17)14(21)13-12(10)15(22)20(8-19-13)6-4-9-3-1-2-5-18-9/h1-3,5,7-8,21H,4,6H2 |
| InChIKey | WECLGJIQRDGFQY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |