About 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide
5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide (PubChem CID 143114070) has the molecular formula C16H14Cl2N4O3
and a molecular weight of 381.22 g/mol. Its IUPAC name is 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide.
Molecular Properties
| Compound Name | 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide |
| PubChem CID | 143114070 |
| Molecular Formula | C16H14Cl2N4O3 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide |
| SMILES | CCn1cnc2c(O)c(Cl)cc(Cl)c2c1=O.O=CNc1ccccn1 |
| InChI | InChI=1S/C10H8Cl2N2O2.C6H6N2O/c1-2-14-4-13-8-7(10(14)16)5(11)3-6(12)9(8)15;9-5-8-6-3-1-2-4-7-6/h3-4,15H,2H2,1H3;1-5H,(H,7,8,9) |
| InChIKey | NWOYEDLVUNFEEC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide?
The IUPAC name of 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide (CID 143114070) is 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide.
What is the SMILES notation for 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide?
The canonical SMILES for 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide is CCn1cnc2c(O)c(Cl)cc(Cl)c2c1=O.O=CNc1ccccn1.
What is the InChIKey of 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide?
The InChIKey is NWOYEDLVUNFEEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N2O2.C6H6N2O/c1-2-14-4-13-8-7(10(14)16)5(11)3-6(12)9(8)15;9-5-8-6-3-1-2-4-7-6/h3-4,15H,2H2,1H3;1-5H,(H,7,8,9).
What are the key properties of 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide?
5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide has a molecular weight of 381.22 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-3-ethyl-8-hydroxyquinazolin-4-one;N-pyridin-2-ylformamide is sourced from PubChem (CID 143114070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).