C16H16Br2Cl2N4O2 — CID 23651959
5,7-dichloro-8-hydroxy-3-[2-(pyridin-4-ylmethylamino)ethyl]quinazolin-4-one;dihydrobromide (PubChem CID 23651959) has the molecular formula C16H16Br2Cl2N4O2 and a molecular weight of 527.04 g/mol. Its IUPAC name is 5,7-dichloro-8-hydroxy-3-[2-(pyridin-4-ylmethylamino)ethyl]quinazolin-4-one;dihydrobromide.
| Compound Name | 5,7-dichloro-8-hydroxy-3-[2-(pyridin-4-ylmethylamino)ethyl]quinazolin-4-one;dihydrobromide |
|---|---|
| PubChem CID | 23651959 |
| Molecular Formula | C16H16Br2Cl2N4O2 |
| Molecular Weight | 527.04 g/mol |
| Exact Mass | 523.90 |
| IUPAC Name | 5,7-dichloro-8-hydroxy-3-[2-(pyridin-4-ylmethylamino)ethyl]quinazolin-4-one;dihydrobromide |
| SMILES | Br.Br.O=c1c2c(Cl)cc(Cl)c(O)c2ncn1CCNCc1ccncc1 |
| InChI | InChI=1S/C16H14Cl2N4O2.2BrH/c17-11-7-12(18)15(23)14-13(11)16(24)22(9-21-14)6-5-20-8-10-1-3-19-4-2-10;;/h1-4,7,9,20,23H,5-6,8H2;2*1H |
| InChIKey | SSJFHSMOSPVWKY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.04 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|