About 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide
3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide (PubChem CID 162321860) has the molecular formula C12H11BrCl2N2O2
and a molecular weight of 366.04 g/mol. Its IUPAC name is 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide.
Molecular Properties
| Compound Name | 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide |
| PubChem CID | 162321860 |
| Molecular Formula | C12H11BrCl2N2O2 |
| Molecular Weight | 366.04 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide |
| SMILES | Br.C/C=C/Cn1cnc2c(O)c(Cl)cc(Cl)c2c1=O |
| InChI | InChI=1S/C12H10Cl2N2O2.BrH/c1-2-3-4-16-6-15-10-9(12(16)18)7(13)5-8(14)11(10)17;/h2-3,5-6,17H,4H2,1H3;1H/b3-2+; |
| InChIKey | RYENMMVZBPRSJF-SQQVDAMQSA-N |
| XLogP | 3.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.04 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide?
The IUPAC name of 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide (CID 162321860) is 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide.
What is the SMILES notation for 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide?
The canonical SMILES for 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide is Br.C/C=C/Cn1cnc2c(O)c(Cl)cc(Cl)c2c1=O.
What is the InChIKey of 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide?
The InChIKey is RYENMMVZBPRSJF-SQQVDAMQSA-N. The full InChI is InChI=1S/C12H10Cl2N2O2.BrH/c1-2-3-4-16-6-15-10-9(12(16)18)7(13)5-8(14)11(10)17;/h2-3,5-6,17H,4H2,1H3;1H/b3-2+;.
What are the key properties of 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide?
3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide has a molecular weight of 366.04 g/mol, XLogP of 3.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide is sourced from PubChem (CID 162321860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).