C12H11BrCl2N2O2 — CID 162321860
3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide (PubChem CID 162321860) has the molecular formula C12H11BrCl2N2O2 and a molecular weight of 366.04 g/mol. Its IUPAC name is 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide.
| Compound Name | 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide |
|---|---|
| PubChem CID | 162321860 |
| Molecular Formula | C12H11BrCl2N2O2 |
| Molecular Weight | 366.04 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | 3-[(E)-but-2-enyl]-5,7-dichloro-8-hydroxyquinazolin-4-one;hydrobromide |
| SMILES | Br.C/C=C/Cn1cnc2c(O)c(Cl)cc(Cl)c2c1=O |
| InChI | InChI=1S/C12H10Cl2N2O2.BrH/c1-2-3-4-16-6-15-10-9(12(16)18)7(13)5-8(14)11(10)17;/h2-3,5-6,17H,4H2,1H3;1H/b3-2+; |
| InChIKey | RYENMMVZBPRSJF-SQQVDAMQSA-N |
| XLogP | 3.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.04 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|