C42H40I2N10O4S2 — CID 159287463
8-(2,5-dimethoxyphenyl)sulfanyl-9-[2-(3-iodophenyl)ethyl]purin-6-amine;8-(2,5-dimethoxyphenyl)sulfanyl-3-[2-(3-iodophenyl)ethyl]-7H-purin-6-imine (PubChem CID 159287463) has the molecular formula C42H40I2N10O4S2 and a molecular weight of 1066.79 g/mol. Its IUPAC name is 8-(2,5-dimethoxyphenyl)sulfanyl-9-[2-(3-iodophenyl)ethyl]purin-6-amine;8-(2,5-dimethoxyphenyl)sulfanyl-3-[2-(3-iodophenyl)ethyl]-7H-purin-6-imine.
| Compound Name | 8-(2,5-dimethoxyphenyl)sulfanyl-9-[2-(3-iodophenyl)ethyl]purin-6-amine;8-(2,5-dimethoxyphenyl)sulfanyl-3-[2-(3-iodophenyl)ethyl]-7H-purin-6-imine |
|---|---|
| PubChem CID | 159287463 |
| Molecular Formula | C42H40I2N10O4S2 |
| Molecular Weight | 1066.79 g/mol |
| Exact Mass | 1066.08 |
| IUPAC Name | 8-(2,5-dimethoxyphenyl)sulfanyl-9-[2-(3-iodophenyl)ethyl]purin-6-amine;8-(2,5-dimethoxyphenyl)sulfanyl-3-[2-(3-iodophenyl)ethyl]-7H-purin-6-imine |
| SMILES | COc1ccc(OC)c(Sc2nc3c(N)ncnc3n2CCc2cccc(I)c2)c1.[H]/N=c1\ncn(CCc2cccc(I)c2)c2nc(Sc3cc(OC)ccc3OC)[nH]c12 |
| InChI | InChI=1S/2C21H20IN5O2S/c1-28-15-6-7-16(29-2)17(11-15)30-21-25-18-19(23)24-12-27(20(18)26-21)9-8-13-4-3-5-14(22)10-13;1-28-15-6-7-16(29-2)17(11-15)30-21-26-18-19(23)24-12-25-20(18)27(21)9-8-13-4-3-5-14(22)10-13/h3-7,10-12,23H,8-9H2,1-2H3,(H,25,26);3-7,10-12H,8-9H2,1-2H3,(H2,23,24,25)/b23-19-; |
| InChIKey | SLARMAGGKOINID-PDEWKSAASA-N |
| XLogP | 8.68 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.79 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|