C21H19Cl2N5O2S — CID 135906921
3-[2-(2,4-dichlorophenyl)ethyl]-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-6-imine (PubChem CID 135906921) has the molecular formula C21H19Cl2N5O2S and a molecular weight of 476.39 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethyl]-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-6-imine.
| Compound Name | 3-[2-(2,4-dichlorophenyl)ethyl]-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-6-imine |
|---|---|
| PubChem CID | 135906921 |
| Molecular Formula | C21H19Cl2N5O2S |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)ethyl]-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(CCc2ccc(Cl)cc2Cl)c2nc(Sc3cc(OC)ccc3OC)[nH]c12 |
| InChI | InChI=1S/C21H19Cl2N5O2S/c1-29-14-5-6-16(30-2)17(10-14)31-21-26-18-19(24)25-11-28(20(18)27-21)8-7-12-3-4-13(22)9-15(12)23/h3-6,9-11,24H,7-8H2,1-2H3,(H,26,27)/b24-19- |
| InChIKey | CLMYBRQINWQSJH-CLCOLTQESA-N |
| XLogP | 4.96 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |