C8H11N5O2 — CID 135839799
(2R)-3-(6-imino-7H-purin-3-yl)propane-1,2-diol (PubChem CID 135839799) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is (2R)-3-(6-imino-7H-purin-3-yl)propane-1,2-diol.
| Compound Name | (2R)-3-(6-imino-7H-purin-3-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 135839799 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (2R)-3-(6-imino-7H-purin-3-yl)propane-1,2-diol |
| SMILES | [H]/N=c1\ncn(C[C@@H](O)CO)c2nc[nH]c12 |
| InChI | InChI=1S/C8H11N5O2/c9-7-6-8(11-3-10-6)13(4-12-7)1-5(15)2-14/h3-5,9,14-15H,1-2H2,(H,10,11)/b9-7-/t5-/m1/s1 |
| InChIKey | XNEBSVYACKTMFE-MQMLQLMOSA-N |
| XLogP | -1.41 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |