About 3-bromo-7H-purin-6-imine
3-bromo-7H-purin-6-imine (PubChem CID 136992972) has the molecular formula C5H4BrN5
and a molecular weight of 214.03 g/mol. Its IUPAC name is 3-bromo-7H-purin-6-imine.
Molecular Properties
| Compound Name | 3-bromo-7H-purin-6-imine |
| PubChem CID | 136992972 |
| Molecular Formula | C5H4BrN5 |
| Molecular Weight | 214.03 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | 3-bromo-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Br)c2nc[nH]c12 |
| InChI | InChI=1S/C5H4BrN5/c6-11-2-10-4(7)3-5(11)9-1-8-3/h1-2,7H,(H,8,9)/b7-4- |
| InChIKey | DATJYHZSASUZHC-DAXSKMNVSA-N |
| XLogP | 0.40 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.03 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-7H-purin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-7H-purin-6-imine?
The IUPAC name of 3-bromo-7H-purin-6-imine (CID 136992972) is 3-bromo-7H-purin-6-imine.
What is the SMILES notation for 3-bromo-7H-purin-6-imine?
The canonical SMILES for 3-bromo-7H-purin-6-imine is [H]/N=c1\ncn(Br)c2nc[nH]c12.
What is the InChIKey of 3-bromo-7H-purin-6-imine?
The InChIKey is DATJYHZSASUZHC-DAXSKMNVSA-N. The full InChI is InChI=1S/C5H4BrN5/c6-11-2-10-4(7)3-5(11)9-1-8-3/h1-2,7H,(H,8,9)/b7-4-.
What are the key properties of 3-bromo-7H-purin-6-imine?
3-bromo-7H-purin-6-imine has a molecular weight of 214.03 g/mol, XLogP of 0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7H-purin-6-imine is sourced from PubChem (CID 136992972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).