C10H18N6O4P+ — CID 175338398
2-[hydroxy-[(6-imino-7H-purin-3-yl)oxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 175338398) has the molecular formula C10H18N6O4P+ and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-[hydroxy-[(6-imino-7H-purin-3-yl)oxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(6-imino-7H-purin-3-yl)oxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 175338398 |
| Molecular Formula | C10H18N6O4P+ |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-[hydroxy-[(6-imino-7H-purin-3-yl)oxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | [H]/N=c1\ncn(OP(=O)(O)OCC[N+](C)(C)C)c2nc[nH]c12 |
| InChI | InChI=1S/C10H17N6O4P/c1-16(2,3)4-5-19-21(17,18)20-15-7-14-9(11)8-10(15)13-6-12-8/h6-7,11H,4-5H2,1-3H3,(H-,12,13,17,18)/p+1/b11-9- |
| InChIKey | GEIDSVOXQSLBQX-LUAWRHEFSA-O |
| XLogP | -0.51 |
| TPSA | 126.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|