C15H12N6 — CID 138740765
3-(quinolin-2-ylmethyl)-7H-purin-6-imine (PubChem CID 138740765) has the molecular formula C15H12N6 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-(quinolin-2-ylmethyl)-7H-purin-6-imine.
| Compound Name | 3-(quinolin-2-ylmethyl)-7H-purin-6-imine |
|---|---|
| PubChem CID | 138740765 |
| Molecular Formula | C15H12N6 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-(quinolin-2-ylmethyl)-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2ccc3ccccc3n2)c2nc[nH]c12 |
| InChI | InChI=1S/C15H12N6/c16-14-13-15(18-8-17-13)21(9-19-14)7-11-6-5-10-3-1-2-4-12(10)20-11/h1-6,8-9,16H,7H2,(H,17,18)/b16-14- |
| InChIKey | BVUQPPRFUZKIOK-PEZBUJJGSA-N |
| XLogP | 1.84 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |