C15H25N7O2 — CID 135750406
(2R)-3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol (PubChem CID 135750406) has the molecular formula C15H25N7O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (2R)-3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol.
| Compound Name | (2R)-3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 135750406 |
| Molecular Formula | C15H25N7O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (2R)-3-[6-imino-8-(4-propylpiperazin-1-yl)-7H-purin-3-yl]propane-1,2-diol |
| SMILES | [H]/N=c1\ncn(C[C@@H](O)CO)c2nc(N3CCN(CCC)CC3)[nH]c12 |
| InChI | InChI=1S/C15H25N7O2/c1-2-3-20-4-6-21(7-5-20)15-18-12-13(16)17-10-22(14(12)19-15)8-11(24)9-23/h10-11,16,23-24H,2-9H2,1H3,(H,18,19)/b16-13-/t11-/m1/s1 |
| InChIKey | FGVJTGHXAAJTLF-KDUNNAQNSA-N |
| XLogP | -0.88 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |