C27H34Cl2N6O2 — CID 67538552
1-[4-(4-benzhydrylpiperazin-1-yl)butyl]-3-methyl-7H-purine-2,6-dione;dihydrochloride (PubChem CID 67538552) has the molecular formula C27H34Cl2N6O2 and a molecular weight of 545.52 g/mol. Its IUPAC name is 1-[4-(4-benzhydrylpiperazin-1-yl)butyl]-3-methyl-7H-purine-2,6-dione;dihydrochloride.
| Compound Name | 1-[4-(4-benzhydrylpiperazin-1-yl)butyl]-3-methyl-7H-purine-2,6-dione;dihydrochloride |
|---|---|
| PubChem CID | 67538552 |
| Molecular Formula | C27H34Cl2N6O2 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 1-[4-(4-benzhydrylpiperazin-1-yl)butyl]-3-methyl-7H-purine-2,6-dione;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(=O)n(CCCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c(=O)c2[nH]cnc21 |
| InChI | InChI=1S/C27H32N6O2.2ClH/c1-30-25-23(28-20-29-25)26(34)33(27(30)35)15-9-8-14-31-16-18-32(19-17-31)24(21-10-4-2-5-11-21)22-12-6-3-7-13-22;;/h2-7,10-13,20,24H,8-9,14-19H2,1H3,(H,28,29);2*1H |
| InChIKey | HQOVLJSJNNENCY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|