C32H35N5O2 — CID 110188733
12-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-8-ethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one (PubChem CID 110188733) has the molecular formula C32H35N5O2 and a molecular weight of 521.67 g/mol. Its IUPAC name is 12-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-8-ethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one.
| Compound Name | 12-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-8-ethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 110188733 |
| Molecular Formula | C32H35N5O2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 12-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-8-ethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
| SMILES | CCn1c(=O)c2cccn2c2nc(OCCCN3CCN(C(c4ccccc4)c4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C32H35N5O2/c1-2-36-27-16-17-29(33-31(27)37-19-9-15-28(37)32(36)38)39-24-10-18-34-20-22-35(23-21-34)30(25-11-5-3-6-12-25)26-13-7-4-8-14-26/h3-9,11-17,19,30H,2,10,18,20-24H2,1H3 |
| InChIKey | BERNHKVLENLGEP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|