C32H36N6O2 — CID 110173140
8-[3-(4-benzhydrylpiperazin-1-yl)propyl]-3-ethyl-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione (PubChem CID 110173140) has the molecular formula C32H36N6O2 and a molecular weight of 536.68 g/mol. Its IUPAC name is 8-[3-(4-benzhydrylpiperazin-1-yl)propyl]-3-ethyl-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione.
| Compound Name | 8-[3-(4-benzhydrylpiperazin-1-yl)propyl]-3-ethyl-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione |
|---|---|
| PubChem CID | 110173140 |
| Molecular Formula | C32H36N6O2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 8-[3-(4-benzhydrylpiperazin-1-yl)propyl]-3-ethyl-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione |
| SMILES | CCc1nc(C)c2c(=O)n(CCCN3CCN(C(c4ccccc4)c4ccccc4)CC3)c3ccc(=O)[nH]c3n12 |
| InChI | InChI=1S/C32H36N6O2/c1-3-27-33-23(2)29-32(40)37(26-15-16-28(39)34-31(26)38(27)29)18-10-17-35-19-21-36(22-20-35)30(24-11-6-4-7-12-24)25-13-8-5-9-14-25/h4-9,11-16,30H,3,10,17-22H2,1-2H3,(H,34,39) |
| InChIKey | PQOFGUPZZCKMKP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |