C26H32N6O3 — CID 110173169
3-ethyl-8-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione (PubChem CID 110173169) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 3-ethyl-8-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione.
| Compound Name | 3-ethyl-8-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione |
|---|---|
| PubChem CID | 110173169 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 3-ethyl-8-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10-tetraene-7,12-dione |
| SMILES | CCc1nc(C)c2c(=O)n(CCCN3CCN(c4ccc(OC)cc4)CC3)c3ccc(=O)[nH]c3n12 |
| InChI | InChI=1S/C26H32N6O3/c1-4-22-27-18(2)24-26(34)31(21-10-11-23(33)28-25(21)32(22)24)13-5-12-29-14-16-30(17-15-29)19-6-8-20(35-3)9-7-19/h6-11H,4-5,12-17H2,1-3H3,(H,28,33) |
| InChIKey | PKNJQFKTJLBZHZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|