C52H45N4O4+ — CID 102013619
methyl (2S)-3-[3-[(4-nitrophenyl)methyl]-1-tritylimidazol-1-ium-4-yl]-2-(tritylamino)propanoate (PubChem CID 102013619) has the molecular formula C52H45N4O4+ and a molecular weight of 789.96 g/mol. Its IUPAC name is methyl (2S)-3-[3-[(4-nitrophenyl)methyl]-1-tritylimidazol-1-ium-4-yl]-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-[3-[(4-nitrophenyl)methyl]-1-tritylimidazol-1-ium-4-yl]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 102013619 |
| Molecular Formula | C52H45N4O4+ |
| Molecular Weight | 789.96 g/mol |
| Exact Mass | 789.34 |
| IUPAC Name | methyl (2S)-3-[3-[(4-nitrophenyl)methyl]-1-tritylimidazol-1-ium-4-yl]-2-(tritylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1c[n+](C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1Cc1ccc([N+](=O)[O-])cc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C52H45N4O4/c1-60-50(57)49(53-51(41-20-8-2-9-21-41,42-22-10-3-11-23-42)43-24-12-4-13-25-43)36-48-38-55(39-54(48)37-40-32-34-47(35-33-40)56(58)59)52(44-26-14-5-15-27-44,45-28-16-6-17-29-45)46-30-18-7-19-31-46/h2-35,38-39,49,53H,36-37H2,1H3/q+1/t49-/m0/s1 |
| InChIKey | KGADEJWPGFMJFO-GGCSAXROSA-N |
| XLogP | 9.24 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.96 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|