C22H22N4O5 — CID 72723148
methyl (2S)-2-acetamido-3-[1-benzyl-5-(4-nitrophenyl)imidazol-4-yl]propanoate (PubChem CID 72723148) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-[1-benzyl-5-(4-nitrophenyl)imidazol-4-yl]propanoate.
| Compound Name | methyl (2S)-2-acetamido-3-[1-benzyl-5-(4-nitrophenyl)imidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 72723148 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | methyl (2S)-2-acetamido-3-[1-benzyl-5-(4-nitrophenyl)imidazol-4-yl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ncn(Cc2ccccc2)c1-c1ccc([N+](=O)[O-])cc1)NC(C)=O |
| InChI | InChI=1S/C22H22N4O5/c1-15(27)24-20(22(28)31-2)12-19-21(17-8-10-18(11-9-17)26(29)30)25(14-23-19)13-16-6-4-3-5-7-16/h3-11,14,20H,12-13H2,1-2H3,(H,24,27)/t20-/m0/s1 |
| InChIKey | FESVJYNPKCJHBF-FQEVSTJZSA-N |
| XLogP | 2.73 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|