C28H34BCl2NO6 — CID 163462406
methyl 2-[(2,6-dichlorobenzoyl)amino]-3-[8-(6,6,7,7-tetramethyl-1,5,2-dioxaborepan-2-yl)-3,4-dihydro-2H-chromen-5-yl]propanoate (PubChem CID 163462406) has the molecular formula C28H34BCl2NO6 and a molecular weight of 562.30 g/mol. Its IUPAC name is methyl 2-[(2,6-dichlorobenzoyl)amino]-3-[8-(6,6,7,7-tetramethyl-1,5,2-dioxaborepan-2-yl)-3,4-dihydro-2H-chromen-5-yl]propanoate.
| Compound Name | methyl 2-[(2,6-dichlorobenzoyl)amino]-3-[8-(6,6,7,7-tetramethyl-1,5,2-dioxaborepan-2-yl)-3,4-dihydro-2H-chromen-5-yl]propanoate |
|---|---|
| PubChem CID | 163462406 |
| Molecular Formula | C28H34BCl2NO6 |
| Molecular Weight | 562.30 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | methyl 2-[(2,6-dichlorobenzoyl)amino]-3-[8-(6,6,7,7-tetramethyl-1,5,2-dioxaborepan-2-yl)-3,4-dihydro-2H-chromen-5-yl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(B2CCOC(C)(C)C(C)(C)O2)c2c1CCCO2)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C28H34BCl2NO6/c1-27(2)28(3,4)38-29(13-15-37-27)19-12-11-17(18-8-7-14-36-24(18)19)16-22(26(34)35-5)32-25(33)23-20(30)9-6-10-21(23)31/h6,9-12,22H,7-8,13-16H2,1-5H3,(H,32,33) |
| InChIKey | BPSFWYSZWILFSB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|