C17H25NO4 — CID 120703228
4-methoxy-2-[(4-methyl-4-phenylpentanoyl)amino]butanoic acid (PubChem CID 120703228) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-methoxy-2-[(4-methyl-4-phenylpentanoyl)amino]butanoic acid.
| Compound Name | 4-methoxy-2-[(4-methyl-4-phenylpentanoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 120703228 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-methoxy-2-[(4-methyl-4-phenylpentanoyl)amino]butanoic acid |
| SMILES | COCCC(NC(=O)CCC(C)(C)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25NO4/c1-17(2,13-7-5-4-6-8-13)11-9-15(19)18-14(16(20)21)10-12-22-3/h4-8,14H,9-12H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | GQPWXRFOMPRXOS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |