C37H37N5O11S — CID 125114436
methyl (4S)-4-(3,5-dinitro-4-oxo-1-pyridinyl)-5-[[(2S)-1-[(2-ethoxy-2-oxoethyl)amino]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-5-oxopentanoate (PubChem CID 125114436) has the molecular formula C37H37N5O11S and a molecular weight of 759.79 g/mol. Its IUPAC name is methyl (4S)-4-(3,5-dinitro-4-oxo-1-pyridinyl)-5-[[(2S)-1-[(2-ethoxy-2-oxoethyl)amino]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-5-oxopentanoate.
| Compound Name | methyl (4S)-4-(3,5-dinitro-4-oxo-1-pyridinyl)-5-[[(2S)-1-[(2-ethoxy-2-oxoethyl)amino]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 125114436 |
| Molecular Formula | C37H37N5O11S |
| Molecular Weight | 759.79 g/mol |
| Exact Mass | 759.22 |
| IUPAC Name | methyl (4S)-4-(3,5-dinitro-4-oxo-1-pyridinyl)-5-[[(2S)-1-[(2-ethoxy-2-oxoethyl)amino]-1-oxo-3-tritylsulfanylpropan-2-yl]amino]-5-oxopentanoate |
| SMILES | CCOC(=O)CNC(=O)[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](CCC(=O)OC)n1cc([N+](=O)[O-])c(=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H37N5O11S/c1-3-53-33(44)21-38-35(46)28(24-54-37(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27)39-36(47)29(19-20-32(43)52-2)40-22-30(41(48)49)34(45)31(23-40)42(50)51/h4-18,22-23,28-29H,3,19-21,24H2,1-2H3,(H,38,46)(H,39,47)/t28-,29+/m1/s1 |
| InChIKey | CVWIWHGFYQQPTO-WDYNHAJCSA-N |
| XLogP | 4.05 |
| TPSA | 219.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|