C31H35ClN4O2S2 — CID 139669832
2-(1H-imidazol-5-ylmethylsulfanyl)-2-methyl-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]propanamide;hydrochloride (PubChem CID 139669832) has the molecular formula C31H35ClN4O2S2 and a molecular weight of 595.23 g/mol. Its IUPAC name is 2-(1H-imidazol-5-ylmethylsulfanyl)-2-methyl-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]propanamide;hydrochloride.
| Compound Name | 2-(1H-imidazol-5-ylmethylsulfanyl)-2-methyl-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 139669832 |
| Molecular Formula | C31H35ClN4O2S2 |
| Molecular Weight | 595.23 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | 2-(1H-imidazol-5-ylmethylsulfanyl)-2-methyl-N-[(2R)-1-(methylamino)-1-oxo-3-tritylsulfanylpropan-2-yl]propanamide;hydrochloride |
| SMILES | CNC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(C)(C)SCc1cnc[nH]1.Cl |
| InChI | InChI=1S/C31H34N4O2S2.ClH/c1-30(2,38-20-26-19-33-22-34-26)29(37)35-27(28(36)32-3)21-39-31(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25;/h4-19,22,27H,20-21H2,1-3H3,(H,32,36)(H,33,34)(H,35,37);1H/t27-;/m0./s1 |
| InChIKey | UHWWPHPGXXGDHW-YCBFMBTMSA-N |
| XLogP | 5.80 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.23 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|