C12H19N3O3S2 — CID 139669801
(2R)-2-[[2-[2-(1H-imidazol-2-yl)ethylsulfanyl]-2-methylpropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 139669801) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is (2R)-2-[[2-[2-(1H-imidazol-2-yl)ethylsulfanyl]-2-methylpropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[2-[2-(1H-imidazol-2-yl)ethylsulfanyl]-2-methylpropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 139669801 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (2R)-2-[[2-[2-(1H-imidazol-2-yl)ethylsulfanyl]-2-methylpropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)(SCCc1ncc[nH]1)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C12H19N3O3S2/c1-12(2,11(18)15-8(7-19)10(16)17)20-6-3-9-13-4-5-14-9/h4-5,8,19H,3,6-7H2,1-2H3,(H,13,14)(H,15,18)(H,16,17)/t8-/m0/s1 |
| InChIKey | FAAJYXANTUKIGR-QMMMGPOBSA-N |
| XLogP | 0.96 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|