C53H52ClN3O5S2 — CID 118671616
ethyl 2-[[1-[2-[(2-chloroacetyl)amino]-3-tritylsulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-tritylsulfanylpropanoate (PubChem CID 118671616) has the molecular formula C53H52ClN3O5S2 and a molecular weight of 910.60 g/mol. Its IUPAC name is ethyl 2-[[1-[2-[(2-chloroacetyl)amino]-3-tritylsulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-tritylsulfanylpropanoate.
| Compound Name | ethyl 2-[[1-[2-[(2-chloroacetyl)amino]-3-tritylsulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 118671616 |
| Molecular Formula | C53H52ClN3O5S2 |
| Molecular Weight | 910.60 g/mol |
| Exact Mass | 909.30 |
| IUPAC Name | ethyl 2-[[1-[2-[(2-chloroacetyl)amino]-3-tritylsulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-tritylsulfanylpropanoate |
| SMILES | CCOC(=O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C1CCCN1C(=O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CCl |
| InChI | InChI=1S/C53H52ClN3O5S2/c1-2-62-51(61)46(38-64-53(42-28-15-6-16-29-42,43-30-17-7-18-31-43)44-32-19-8-20-33-44)56-49(59)47-34-21-35-57(47)50(60)45(55-48(58)36-54)37-63-52(39-22-9-3-10-23-39,40-24-11-4-12-25-40)41-26-13-5-14-27-41/h3-20,22-33,45-47H,2,21,34-38H2,1H3,(H,55,58)(H,56,59) |
| InChIKey | FBJADTIYMLZXHR-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.60 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|