C46H42N2O3S — CID 99653857
(2R)-1-[(2S)-2-(tritylamino)-3-tritylsulfanylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 99653857) has the molecular formula C46H42N2O3S and a molecular weight of 702.92 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-(tritylamino)-3-tritylsulfanylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(2S)-2-(tritylamino)-3-tritylsulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 99653857 |
| Molecular Formula | C46H42N2O3S |
| Molecular Weight | 702.92 g/mol |
| Exact Mass | 702.29 |
| IUPAC Name | (2R)-1-[(2S)-2-(tritylamino)-3-tritylsulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1C(=O)[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H42N2O3S/c49-43(48-33-19-32-42(48)44(50)51)41(47-45(35-20-7-1-8-21-35,36-22-9-2-10-23-36)37-24-11-3-12-25-37)34-52-46(38-26-13-4-14-27-38,39-28-15-5-16-29-39)40-30-17-6-18-31-40/h1-18,20-31,41-42,47H,19,32-34H2,(H,50,51)/t41-,42-/m1/s1 |
| InChIKey | BLDQRSJYJVHQPA-NCRNUEESSA-N |
| XLogP | 8.74 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.92 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|