C36H31NO4S — CID 90322330
methyl (2S)-2-[[(E)-3-(6-hydroxynaphthalen-2-yl)prop-2-enoyl]amino]-3-tritylsulfanylpropanoate (PubChem CID 90322330) has the molecular formula C36H31NO4S and a molecular weight of 573.71 g/mol. Its IUPAC name is methyl (2S)-2-[[(E)-3-(6-hydroxynaphthalen-2-yl)prop-2-enoyl]amino]-3-tritylsulfanylpropanoate.
| Compound Name | methyl (2S)-2-[[(E)-3-(6-hydroxynaphthalen-2-yl)prop-2-enoyl]amino]-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 90322330 |
| Molecular Formula | C36H31NO4S |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | methyl (2S)-2-[[(E)-3-(6-hydroxynaphthalen-2-yl)prop-2-enoyl]amino]-3-tritylsulfanylpropanoate |
| SMILES | COC(=O)[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)/C=C/c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C36H31NO4S/c1-41-35(40)33(37-34(39)22-18-26-17-19-28-24-32(38)21-20-27(28)23-26)25-42-36(29-11-5-2-6-12-29,30-13-7-3-8-14-30)31-15-9-4-10-16-31/h2-24,33,38H,25H2,1H3,(H,37,39)/b22-18+/t33-/m1/s1 |
| InChIKey | MVCZHGJXQOBQDF-KMWBYXOHSA-N |
| XLogP | 6.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|