C34H34N2O3S — CID 123261260
methyl (2S)-2-[3-[4-(dimethylamino)phenyl]prop-2-enoylamino]-3-tritylsulfanylpropanoate (PubChem CID 123261260) has the molecular formula C34H34N2O3S and a molecular weight of 550.72 g/mol. Its IUPAC name is methyl (2S)-2-[3-[4-(dimethylamino)phenyl]prop-2-enoylamino]-3-tritylsulfanylpropanoate.
| Compound Name | methyl (2S)-2-[3-[4-(dimethylamino)phenyl]prop-2-enoylamino]-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 123261260 |
| Molecular Formula | C34H34N2O3S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | methyl (2S)-2-[3-[4-(dimethylamino)phenyl]prop-2-enoylamino]-3-tritylsulfanylpropanoate |
| SMILES | COC(=O)[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C34H34N2O3S/c1-36(2)30-22-19-26(20-23-30)21-24-32(37)35-31(33(38)39-3)25-40-34(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-24,31H,25H2,1-3H3,(H,35,37)/t31-/m1/s1 |
| InChIKey | PPXVSKFCQHSKPY-WJOKGBTCSA-N |
| XLogP | 6.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|