C33H37N3O4 — CID 171344343
ethyl (E,4S)-4-[[(2S)-2-[[(Z)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]-5-phenylpent-2-enoate (PubChem CID 171344343) has the molecular formula C33H37N3O4 and a molecular weight of 539.68 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-[[(Z)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]-5-phenylpent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-[[(Z)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 171344343 |
| Molecular Formula | C33H37N3O4 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-[[(Z)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]-5-phenylpent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)/C=C\c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C33H37N3O4/c1-4-40-32(38)22-18-28(23-26-11-7-5-8-12-26)34-33(39)30(24-27-13-9-6-10-14-27)35-31(37)21-17-25-15-19-29(20-16-25)36(2)3/h5-22,28,30H,4,23-24H2,1-3H3,(H,34,39)(H,35,37)/b21-17-,22-18+/t28-,30+/m1/s1 |
| InChIKey | JWPLKCWYGMPRGX-NMBJHOKLSA-N |
| XLogP | 4.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|