C14H11N3O2 — CID 173270130
(E)-2-formyl-N,3-dipyridin-2-ylprop-2-enamide (PubChem CID 173270130) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is (E)-2-formyl-N,3-dipyridin-2-ylprop-2-enamide.
| Compound Name | (E)-2-formyl-N,3-dipyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 173270130 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (E)-2-formyl-N,3-dipyridin-2-ylprop-2-enamide |
| SMILES | O=C/C(=C\c1ccccn1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C14H11N3O2/c18-10-11(9-12-5-1-3-7-15-12)14(19)17-13-6-2-4-8-16-13/h1-10H,(H,16,17,19)/b11-9+ |
| InChIKey | KHRVAMYVUSPMTQ-PKNBQFBNSA-N |
| XLogP | 1.70 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|