C12H13F2N3O3 — CID 108528944
N'-(2,5-difluorophenyl)-N-(3-formamidopropyl)oxamide (PubChem CID 108528944) has the molecular formula C12H13F2N3O3 and a molecular weight of 285.25 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)-N-(3-formamidopropyl)oxamide.
| Compound Name | N'-(2,5-difluorophenyl)-N-(3-formamidopropyl)oxamide |
|---|---|
| PubChem CID | 108528944 |
| Molecular Formula | C12H13F2N3O3 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N'-(2,5-difluorophenyl)-N-(3-formamidopropyl)oxamide |
| SMILES | O=CNCCCNC(=O)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C12H13F2N3O3/c13-8-2-3-9(14)10(6-8)17-12(20)11(19)16-5-1-4-15-7-18/h2-3,6-7H,1,4-5H2,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | WAIUGVPSGUGGRN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|