C13H16N2O5 — CID 108512393
methyl 2-[[2-(2-hydroxypropylamino)-2-oxoacetyl]amino]benzoate (PubChem CID 108512393) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 2-[[2-(2-hydroxypropylamino)-2-oxoacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(2-hydroxypropylamino)-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108512393 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 2-[[2-(2-hydroxypropylamino)-2-oxoacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(=O)NCC(C)O |
| InChI | InChI=1S/C13H16N2O5/c1-8(16)7-14-11(17)12(18)15-10-6-4-3-5-9(10)13(19)20-2/h3-6,8,16H,7H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | GWKPDVHEOYSOIM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|