C21H23N5O4 — CID 163141542
4-[2-[[3-(dimethylamino)phenyl]-phenylmethylidene]hydrazinyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 163141542) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-[2-[[3-(dimethylamino)phenyl]-phenylmethylidene]hydrazinyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 4-[2-[[3-(dimethylamino)phenyl]-phenylmethylidene]hydrazinyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163141542 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-[2-[[3-(dimethylamino)phenyl]-phenylmethylidene]hydrazinyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | CN(C)c1cccc(C(=NNc2ccc([NH+]([O-])O)cc2[NH+]([O-])O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H23N5O4/c1-24(2)17-10-6-9-16(13-17)21(15-7-4-3-5-8-15)23-22-19-12-11-18(25(27)28)14-20(19)26(29)30/h3-14,22,25-27,29H,1-2H3 |
| InChIKey | JYODEXYVTWCSEO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|