C13H12ClN3O5 — CID 163158165
5-[(2-chlorophenyl)carbamoyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 163158165) has the molecular formula C13H12ClN3O5 and a molecular weight of 325.71 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)carbamoyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 5-[(2-chlorophenyl)carbamoyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163158165 |
| Molecular Formula | C13H12ClN3O5 |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 5-[(2-chlorophenyl)carbamoyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | O=C(Nc1ccccc1Cl)c1cc([NH+]([O-])O)cc([NH+]([O-])O)c1 |
| InChI | InChI=1S/C13H12ClN3O5/c14-11-3-1-2-4-12(11)15-13(18)8-5-9(16(19)20)7-10(6-8)17(21)22/h1-7,16-17,19,21H,(H,15,18) |
| InChIKey | PYMYCYMEXBJSOF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|