C22H30N4O6 — CID 163171342
1-N,3-N-dihydroxy-4-[2-[2-(4-methoxycyclohexyl)-1-(4-methoxyphenyl)ethylidene]hydrazinyl]benzene-1,3-diamine oxide (PubChem CID 163171342) has the molecular formula C22H30N4O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is 1-N,3-N-dihydroxy-4-[2-[2-(4-methoxycyclohexyl)-1-(4-methoxyphenyl)ethylidene]hydrazinyl]benzene-1,3-diamine oxide.
| Compound Name | 1-N,3-N-dihydroxy-4-[2-[2-(4-methoxycyclohexyl)-1-(4-methoxyphenyl)ethylidene]hydrazinyl]benzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163171342 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-N,3-N-dihydroxy-4-[2-[2-(4-methoxycyclohexyl)-1-(4-methoxyphenyl)ethylidene]hydrazinyl]benzene-1,3-diamine oxide |
| SMILES | COc1ccc(C(CC2CCC(OC)CC2)=NNc2ccc([NH+]([O-])O)cc2[NH+]([O-])O)cc1 |
| InChI | InChI=1S/C22H30N4O6/c1-31-18-8-3-15(4-9-18)13-21(16-5-10-19(32-2)11-6-16)24-23-20-12-7-17(25(27)28)14-22(20)26(29)30/h5-7,10-12,14-15,18,23,25-27,29H,3-4,8-9,13H2,1-2H3 |
| InChIKey | VMNIWNXRSOBGFN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|