C16H10ClN5O6S — CID 136828524
(5S)-2-(2-chlorophenyl)imino-N-(2,4-dinitrophenyl)-4-oxo-1,3-thiazolidine-5-carboxamide (PubChem CID 136828524) has the molecular formula C16H10ClN5O6S and a molecular weight of 435.81 g/mol. Its IUPAC name is (5S)-2-(2-chlorophenyl)imino-N-(2,4-dinitrophenyl)-4-oxo-1,3-thiazolidine-5-carboxamide.
| Compound Name | (5S)-2-(2-chlorophenyl)imino-N-(2,4-dinitrophenyl)-4-oxo-1,3-thiazolidine-5-carboxamide |
|---|---|
| PubChem CID | 136828524 |
| Molecular Formula | C16H10ClN5O6S |
| Molecular Weight | 435.81 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | (5S)-2-(2-chlorophenyl)imino-N-(2,4-dinitrophenyl)-4-oxo-1,3-thiazolidine-5-carboxamide |
| SMILES | O=C1N/C(=N\c2ccccc2Cl)S[C@H]1C(=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10ClN5O6S/c17-9-3-1-2-4-10(9)19-16-20-15(24)13(29-16)14(23)18-11-6-5-8(21(25)26)7-12(11)22(27)28/h1-7,13H,(H,18,23)(H,19,20,24)/t13-/m0/s1 |
| InChIKey | UDTUHMYVLPIEBB-ZDUSSCGKSA-N |
| XLogP | 3.01 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|