C16H16N4O6S — CID 21141599
1-N,3-N-dihydroxy-4-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]benzene-1,3-diamine oxide (PubChem CID 21141599) has the molecular formula C16H16N4O6S and a molecular weight of 392.39 g/mol. Its IUPAC name is 1-N,3-N-dihydroxy-4-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]benzene-1,3-diamine oxide.
| Compound Name | 1-N,3-N-dihydroxy-4-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]benzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 21141599 |
| Molecular Formula | C16H16N4O6S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 1-N,3-N-dihydroxy-4-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]benzene-1,3-diamine oxide |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)Nc1ccc([NH+]([O-])O)cc1[NH+]([O-])O |
| InChI | InChI=1S/C16H16N4O6S/c21-15(8-14-16(22)18-11-3-1-2-4-13(11)27-14)17-10-6-5-9(19(23)24)7-12(10)20(25)26/h1-7,14,19-20,23,25H,8H2,(H,17,21)(H,18,22) |
| InChIKey | QSJHUPCOWKKQDC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|