C24H26F2N4O6S — CID 98387100
2-[(5R)-2-[4-(difluoromethoxy)phenyl]imino-4-oxo-3-pentan-3-yl-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 98387100) has the molecular formula C24H26F2N4O6S and a molecular weight of 536.56 g/mol. Its IUPAC name is 2-[(5R)-2-[4-(difluoromethoxy)phenyl]imino-4-oxo-3-pentan-3-yl-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[(5R)-2-[4-(difluoromethoxy)phenyl]imino-4-oxo-3-pentan-3-yl-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 98387100 |
| Molecular Formula | C24H26F2N4O6S |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 2-[(5R)-2-[4-(difluoromethoxy)phenyl]imino-4-oxo-3-pentan-3-yl-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | CCC(CC)N1C(=O)[C@@H](CC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])S/C1=N\c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H26F2N4O6S/c1-4-15(5-2)29-22(32)20(37-24(29)27-14-6-8-16(9-7-14)36-23(25)26)13-21(31)28-18-11-10-17(35-3)12-19(18)30(33)34/h6-12,15,20,23H,4-5,13H2,1-3H3,(H,28,31)/b27-24-/t20-/m1/s1 |
| InChIKey | SGTNSUOGPUZVDF-XFMXRJAISA-N |
| XLogP | 5.35 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|