C18H16N4O5S — CID 5037401
2-(2-imino-4-oxo-3-phenyl-1,3-thiazolidin-5-yl)-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 5037401) has the molecular formula C18H16N4O5S and a molecular weight of 400.42 g/mol. Its IUPAC name is 2-(2-imino-4-oxo-3-phenyl-1,3-thiazolidin-5-yl)-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-(2-imino-4-oxo-3-phenyl-1,3-thiazolidin-5-yl)-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 5037401 |
| Molecular Formula | C18H16N4O5S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2-(2-imino-4-oxo-3-phenyl-1,3-thiazolidin-5-yl)-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | [H]/N=C1\SC(CC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H16N4O5S/c1-27-12-7-8-13(14(9-12)22(25)26)20-16(23)10-15-17(24)21(18(19)28-15)11-5-3-2-4-6-11/h2-9,15,19H,10H2,1H3,(H,20,23)/b19-18- |
| InChIKey | NVWBQZDFRDBACJ-HNENSFHCSA-N |
| XLogP | 3.02 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|