C19H17N3O6S — CID 7987571
N-(4-methoxy-2-nitrophenyl)-2-[(5S)-2-(3-methoxyphenyl)-4-oxo-1,3-thiazol-5-yl]acetamide (PubChem CID 7987571) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-[(5S)-2-(3-methoxyphenyl)-4-oxo-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-[(5S)-2-(3-methoxyphenyl)-4-oxo-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 7987571 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-[(5S)-2-(3-methoxyphenyl)-4-oxo-1,3-thiazol-5-yl]acetamide |
| SMILES | COc1cccc(C2=NC(=O)[C@H](CC(=O)Nc3ccc(OC)cc3[N+](=O)[O-])S2)c1 |
| InChI | InChI=1S/C19H17N3O6S/c1-27-12-5-3-4-11(8-12)19-21-18(24)16(29-19)10-17(23)20-14-7-6-13(28-2)9-15(14)22(25)26/h3-9,16H,10H2,1-2H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | NAPLPFMAMQEVEA-INIZCTEOSA-N |
| XLogP | 3.03 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|