C19H16ClN5O4S2 — CID 137213568
N-(4-chlorophenyl)-2-[3-(furan-2-ylmethyl)-4-oxo-2-[(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 137213568) has the molecular formula C19H16ClN5O4S2 and a molecular weight of 477.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[3-(furan-2-ylmethyl)-4-oxo-2-[(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[3-(furan-2-ylmethyl)-4-oxo-2-[(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 137213568 |
| Molecular Formula | C19H16ClN5O4S2 |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | N-(4-chlorophenyl)-2-[3-(furan-2-ylmethyl)-4-oxo-2-[(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1SC(=NN=C2CSC(=O)N2)N(Cc2ccco2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN5O4S2/c20-11-3-5-12(6-4-11)21-16(26)8-14-17(27)25(9-13-2-1-7-29-13)18(31-14)24-23-15-10-30-19(28)22-15/h1-7,14H,8-10H2,(H,21,26)(H,22,23,28) |
| InChIKey | RSJXAQBGWJZTAC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 116.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|